C13H11N2NaO5S — CID 74084471
sodium 5-[[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 74084471) has the molecular formula C13H11N2NaO5S and a molecular weight of 330.30 g/mol. Its IUPAC name is sodium 5-[[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 74084471 |
| Molecular Formula | C13H11N2NaO5S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | sodium 5-[[(2-phenylacetyl)hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(Cc1ccccc1)NN=Cc1ccc(S(=O)(=O)[O-])o1.[Na+] |
| InChI | InChI=1S/C13H12N2O5S.Na/c16-12(8-10-4-2-1-3-5-10)15-14-9-11-6-7-13(20-11)21(17,18)19;/h1-7,9H,8H2,(H,15,16)(H,17,18,19);/q;+1/p-1 |
| InChIKey | GXLFBAHEDQVPRB-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|