C24H17BrFN3O4S — CID 2399832
4-[(4-bromophenyl)sulfonylamino]-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 2399832) has the molecular formula C24H17BrFN3O4S and a molecular weight of 542.39 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonylamino]-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonylamino]-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2399832 |
| Molecular Formula | C24H17BrFN3O4S |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonylamino]-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(-c2ccc(F)cc2)o1)c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H17BrFN3O4S/c25-18-5-12-22(13-6-18)34(31,32)29-20-9-3-17(4-10-20)24(30)28-27-15-21-11-14-23(33-21)16-1-7-19(26)8-2-16/h1-15,29H,(H,28,30) |
| InChIKey | RIJMGMIXMQBTGP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|