C23H17N5O6S — CID 6155235
N-[(Z)-[5-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6155235) has the molecular formula C23H17N5O6S and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[(Z)-[5-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-[5-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6155235 |
| Molecular Formula | C23H17N5O6S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-[(Z)-[5-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(S(=O)(=O)Nc3ncccn3)cc2)o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H17N5O6S/c29-22(16-4-8-20-21(12-16)33-14-32-20)27-26-13-17-5-9-19(34-17)15-2-6-18(7-3-15)35(30,31)28-23-24-10-1-11-25-23/h1-13H,14H2,(H,27,29)(H,24,25,28)/b26-13- |
| InChIKey | FEVXREQVQTUMKY-ZMFRSBBQSA-N |
| XLogP | 3.03 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|