C19H12BrClN2O4 — CID 4060449
4-[5-[[(4-bromobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 4060449) has the molecular formula C19H12BrClN2O4 and a molecular weight of 447.67 g/mol. Its IUPAC name is 4-[5-[[(4-bromobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 4-[5-[[(4-bromobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 4060449 |
| Molecular Formula | C19H12BrClN2O4 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | 4-[5-[[(4-bromobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C(NN=Cc1ccc(-c2ccc(C(=O)O)c(Cl)c2)o1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H12BrClN2O4/c20-13-4-1-11(2-5-13)18(24)23-22-10-14-6-8-17(27-14)12-3-7-15(19(25)26)16(21)9-12/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | FSIRHGSGTWVYHR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|