C18H11BrCl2N2O2 — CID 2246358
4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 2246358) has the molecular formula C18H11BrCl2N2O2 and a molecular weight of 438.11 g/mol. Its IUPAC name is 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2246358 |
| Molecular Formula | C18H11BrCl2N2O2 |
| Molecular Weight | 438.11 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(-c2cccc(Cl)c2Cl)o1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11BrCl2N2O2/c19-12-6-4-11(5-7-12)18(24)23-22-10-13-8-9-16(25-13)14-2-1-3-15(20)17(14)21/h1-10H,(H,23,24) |
| InChIKey | CVWYHVVWHSQRMS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.11 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|