C20H10BrCl2IN2O3 — CID 126020919
5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126020919) has the molecular formula C20H10BrCl2IN2O3 and a molecular weight of 604.03 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126020919 |
| Molecular Formula | C20H10BrCl2IN2O3 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 601.83 |
| IUPAC Name | 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cccc(Cl)c2Cl)o1)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C20H10BrCl2IN2O3/c21-11-6-10-7-17(29-19(10)15(24)8-11)20(27)26-25-9-12-4-5-16(28-12)13-2-1-3-14(22)18(13)23/h1-9H,(H,26,27)/b25-9+ |
| InChIKey | XHTIUPRAAGSHFO-YCPBAFNGSA-N |
| XLogP | 7.13 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|