C17H10BrCl2N3O2 — CID 51042923
5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 51042923) has the molecular formula C17H10BrCl2N3O2 and a molecular weight of 439.10 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51042923 |
| Molecular Formula | C17H10BrCl2N3O2 |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 5-bromo-N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cccc(Cl)c2Cl)o1)c1cncc(Br)c1 |
| InChI | InChI=1S/C17H10BrCl2N3O2/c18-11-6-10(7-21-8-11)17(24)23-22-9-12-4-5-15(25-12)13-2-1-3-14(19)16(13)20/h1-9H,(H,23,24)/b22-9+ |
| InChIKey | KPTLUVWDYBJRDO-LSFURLLWSA-N |
| XLogP | 5.17 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|