C13H9BrClN3O — CID 789585
5-bromo-N-[(4-chlorophenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 789585) has the molecular formula C13H9BrClN3O and a molecular weight of 338.59 g/mol. Its IUPAC name is 5-bromo-N-[(4-chlorophenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(4-chlorophenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 789585 |
| Molecular Formula | C13H9BrClN3O |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 5-bromo-N-[(4-chlorophenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H9BrClN3O/c14-11-5-10(7-16-8-11)13(19)18-17-6-9-1-3-12(15)4-2-9/h1-8H,(H,18,19) |
| InChIKey | BJWTUTHTTYKXSR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|