C13H9BrIN3O2 — CID 135643230
5-bromo-N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 135643230) has the molecular formula C13H9BrIN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135643230 |
| Molecular Formula | C13H9BrIN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 444.89 |
| IUPAC Name | 5-bromo-N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)c(I)c1)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H9BrIN3O2/c14-10-4-9(6-16-7-10)13(20)18-17-5-8-1-2-12(19)11(15)3-8/h1-7,19H,(H,18,20)/b17-5+ |
| InChIKey | PCLAOWTYSMBLNV-YAXRCOADSA-N |
| XLogP | 2.92 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|