C18H13Cl2N3O2 — CID 6862986
N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-methylpyridine-3-carboxamide (PubChem CID 6862986) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 6862986 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2ccc(-c3cccc(Cl)c3Cl)o2)cn1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c1-11-5-6-12(9-21-11)18(24)23-22-10-13-7-8-16(25-13)14-3-2-4-15(19)17(14)20/h2-10H,1H3,(H,23,24)/b22-10+ |
| InChIKey | YMNBPGDKINATEW-LSHDLFTRSA-N |
| XLogP | 4.72 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|