C20H16ClN3O4 — CID 3269130
2-chloro-4-[5-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 3269130) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is 2-chloro-4-[5-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3269130 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-chloro-4-[5-[[(2-methylphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1ccc(-c2ccc(C(=O)O)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H16ClN3O4/c1-12-4-2-3-5-17(12)23-20(27)24-22-11-14-7-9-18(28-14)13-6-8-15(19(25)26)16(21)10-13/h2-11H,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | YSHULPPIAGUVIJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|