C21H19N3O5 — CID 3267718
5-[5-[[(2-methoxyphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 3267718) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 5-[5-[[(2-methoxyphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 5-[5-[[(2-methoxyphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 3267718 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 5-[5-[[(2-methoxyphenyl)carbamoylhydrazinylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | COc1ccccc1NC(=O)NN=Cc1ccc(-c2ccc(C)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C21H19N3O5/c1-13-7-8-14(11-16(13)20(25)26)18-10-9-15(29-18)12-22-24-21(27)23-17-5-3-4-6-19(17)28-2/h3-12H,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | MJTZLIBGLYUKIU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|