C20H19ClN2O2 — CID 17245729
N-[(E)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245729) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-[(E)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245729 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[(E)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1ccc(-c2ccc(C)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-14-7-8-15(11-18(14)21)20-10-9-17(25-20)13-23-22-12-16-5-3-4-6-19(16)24-2/h3-11,13,22H,12H2,1-2H3/b23-13+ |
| InChIKey | FUEUUZCDDHMQTR-YDZHTSKRSA-N |
| XLogP | 5.04 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|