C19H17ClN2O2 — CID 56695507
N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-methylaniline (PubChem CID 56695507) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-methylaniline.
| Compound Name | N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-methylaniline |
|---|---|
| PubChem CID | 56695507 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-methylaniline |
| SMILES | COc1ccc(-c2ccc(/C=N/Nc3ccccc3C)o2)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O2/c1-13-5-3-4-6-17(13)22-21-12-15-8-10-18(24-15)14-7-9-19(23-2)16(20)11-14/h3-12,22H,1-2H3/b21-12+ |
| InChIKey | WOIQXKHUMYILHY-CIAFOILYSA-N |
| XLogP | 5.36 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|