C19H16BrN3O2 — CID 4222897
1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 4222897) has the molecular formula C19H16BrN3O2 and a molecular weight of 398.26 g/mol. Its IUPAC name is 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 4222897 |
| Molecular Formula | C19H16BrN3O2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 1-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C19H16BrN3O2/c1-13-4-2-3-5-17(13)22-19(24)23-21-12-16-10-11-18(25-16)14-6-8-15(20)9-7-14/h2-12H,1H3,(H2,22,23,24) |
| InChIKey | LPSVRYHLQFBPBY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|