C15H14ClN3O — CID 5420635
1-[(Z)-(4-chlorophenyl)methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5420635) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 1-[(Z)-(4-chlorophenyl)methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[(Z)-(4-chlorophenyl)methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5420635 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-[(Z)-(4-chlorophenyl)methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)N/N=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O/c1-11-4-2-3-5-14(11)18-15(20)19-17-10-12-6-8-13(16)9-7-12/h2-10H,1H3,(H2,18,19,20)/b17-10- |
| InChIKey | NINULBRYIIICHF-YVLHZVERSA-N |
| XLogP | 3.80 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|