C17H10Cl4N2O — CID 50887505
2,4,6-trichloro-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 50887505) has the molecular formula C17H10Cl4N2O and a molecular weight of 400.09 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 50887505 |
| Molecular Formula | C17H10Cl4N2O |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 2,4,6-trichloro-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | Clc1cccc(-c2ccc(/C=N/Nc3c(Cl)cc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C17H10Cl4N2O/c18-11-3-1-2-10(6-11)16-5-4-13(24-16)9-22-23-17-14(20)7-12(19)8-15(17)21/h1-9,23H/b22-9+ |
| InChIKey | DPZFTPHNYXBNBN-LSFURLLWSA-N |
| XLogP | 7.01 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|