C19H8Cl4F6N2O — CID 2781657
2,6-dichloro-N-[[5-[2,6-dichloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 2781657) has the molecular formula C19H8Cl4F6N2O and a molecular weight of 536.09 g/mol. Its IUPAC name is 2,6-dichloro-N-[[5-[2,6-dichloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dichloro-N-[[5-[2,6-dichloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2781657 |
| Molecular Formula | C19H8Cl4F6N2O |
| Molecular Weight | 536.09 g/mol |
| Exact Mass | 533.93 |
| IUPAC Name | 2,6-dichloro-N-[[5-[2,6-dichloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Cl)c(NN=Cc2ccc(-c3c(Cl)cc(C(F)(F)F)cc3Cl)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H8Cl4F6N2O/c20-11-3-8(18(24,25)26)4-12(21)16(11)15-2-1-10(32-15)7-30-31-17-13(22)5-9(6-14(17)23)19(27,28)29/h1-7,31H |
| InChIKey | GRTJQRCTEXFQLA-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.09 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|