C14H9Cl2F3N2O — CID 136914398
2-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol (PubChem CID 136914398) has the molecular formula C14H9Cl2F3N2O and a molecular weight of 349.14 g/mol. Its IUPAC name is 2-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136914398 |
| Molecular Formula | C14H9Cl2F3N2O |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 2-[[[2,6-dichloro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccccc1C=NNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2F3N2O/c15-10-5-9(14(17,18)19)6-11(16)13(10)21-20-7-8-3-1-2-4-12(8)22/h1-7,21-22H |
| InChIKey | MGMYVRCYDYTWEN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|