C14H7BrCl2F4N2 — CID 46949285
N-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-2,6-dichloro-4-(trifluoromethyl)aniline (PubChem CID 46949285) has the molecular formula C14H7BrCl2F4N2 and a molecular weight of 430.03 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-2,6-dichloro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-2,6-dichloro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 46949285 |
| Molecular Formula | C14H7BrCl2F4N2 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 427.91 |
| IUPAC Name | N-[(E)-(5-bromo-2-fluorophenyl)methylideneamino]-2,6-dichloro-4-(trifluoromethyl)aniline |
| SMILES | Fc1ccc(Br)cc1/C=N/Nc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H7BrCl2F4N2/c15-9-1-2-12(18)7(3-9)6-22-23-13-10(16)4-8(5-11(13)17)14(19,20)21/h1-6,23H/b22-6+ |
| InChIKey | YUQSGCSWISKEAA-GEVRCRHISA-N |
| XLogP | 6.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|