C9H8BrFN2O2 — CID 3569932
methyl N-[(5-bromo-2-fluorophenyl)methylideneamino]carbamate (PubChem CID 3569932) has the molecular formula C9H8BrFN2O2 and a molecular weight of 275.08 g/mol. Its IUPAC name is methyl N-[(5-bromo-2-fluorophenyl)methylideneamino]carbamate.
| Compound Name | methyl N-[(5-bromo-2-fluorophenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 3569932 |
| Molecular Formula | C9H8BrFN2O2 |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | methyl N-[(5-bromo-2-fluorophenyl)methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C9H8BrFN2O2/c1-15-9(14)13-12-5-6-4-7(10)2-3-8(6)11/h2-5H,1H3,(H,13,14) |
| InChIKey | WFHQGEDMZFJHJP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|