C32H25Br2Cl2F7N2O — CID 172930436
1-[(4-tert-butylphenyl)methyl]-2,4-dichlorobenzene;N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 172930436) has the molecular formula C32H25Br2Cl2F7N2O and a molecular weight of 817.26 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2,4-dichlorobenzene;N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2,4-dichlorobenzene;N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 172930436 |
| Molecular Formula | C32H25Br2Cl2F7N2O |
| Molecular Weight | 817.26 g/mol |
| Exact Mass | 813.96 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2,4-dichlorobenzene;N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)c1ccc(Cc2ccc(Cl)cc2Cl)cc1.COc1c(Br)cc(Br)cc1/C=N/Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C17H18Cl2.C15H7Br2F7N2O/c1-17(2,3)14-7-4-12(5-8-14)10-13-6-9-15(18)11-16(13)19;1-27-14-5(2-6(16)3-7(14)17)4-25-26-13-11(20)9(18)8(15(22,23)24)10(19)12(13)21/h4-9,11H,10H2,1-3H3;2-4,26H,1H3/b;25-4+ |
| InChIKey | DPDAWRVQFZJMTM-KEBNBPRXSA-N |
| XLogP | 12.12 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.26 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|