C21H9Cl2F7I2N2O — CID 3110875
N-[[2-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 3110875) has the molecular formula C21H9Cl2F7I2N2O and a molecular weight of 763.02 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3110875 |
| Molecular Formula | C21H9Cl2F7I2N2O |
| Molecular Weight | 763.02 g/mol |
| Exact Mass | 761.81 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NN=Cc1cc(I)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H9Cl2F7I2N2O/c22-10-2-1-8(12(23)4-10)7-35-20-9(3-11(31)5-13(20)32)6-33-34-19-17(26)15(24)14(21(28,29)30)16(25)18(19)27/h1-6,34H,7H2 |
| InChIKey | NRPZCKJGLOCKLT-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.02 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|