C17H9BrCl2F7IN2O — CID 126045152
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-iodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126045152) has the molecular formula C17H9BrCl2F7IN2O and a molecular weight of 667.97 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-iodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-iodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126045152 |
| Molecular Formula | C17H9BrCl2F7IN2O |
| Molecular Weight | 667.97 g/mol |
| Exact Mass | 665.82 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-iodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C17H9BrCl2F7IN2O/c18-11-3-8(6-29-30-17(26,27)15(21,22)16(23,24)25)4-13(28)14(11)31-7-9-1-2-10(19)5-12(9)20/h1-6,30H,7H2/b29-6+ |
| InChIKey | VOJVLQOJDZFRQF-FMSSBYAVSA-N |
| XLogP | 7.65 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.97 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|