C17H10ClF7I2N2O — CID 126036097
N-[(E)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126036097) has the molecular formula C17H10ClF7I2N2O and a molecular weight of 680.53 g/mol. Its IUPAC name is N-[(E)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126036097 |
| Molecular Formula | C17H10ClF7I2N2O |
| Molecular Weight | 680.53 g/mol |
| Exact Mass | 679.85 |
| IUPAC Name | N-[(E)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1cc(I)c(OCc2ccccc2Cl)c(I)c1 |
| InChI | InChI=1S/C17H10ClF7I2N2O/c18-11-4-2-1-3-10(11)8-30-14-12(26)5-9(6-13(14)27)7-28-29-17(24,25)15(19,20)16(21,22)23/h1-7,29H,8H2/b28-7+ |
| InChIKey | AAZIJJPAQPXNBD-WBSLIQCRSA-N |
| XLogP | 6.84 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.53 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|