C21H13BrF7IN2O — CID 126044898
N-[(E)-[3-bromo-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126044898) has the molecular formula C21H13BrF7IN2O and a molecular weight of 649.14 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[3-bromo-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126044898 |
| Molecular Formula | C21H13BrF7IN2O |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 647.91 |
| IUPAC Name | N-[(E)-[3-bromo-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1cc(Br)c(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C21H13BrF7IN2O/c22-16-8-12(10-31-32-21(28,29)19(23,24)20(25,26)27)9-17(30)18(16)33-11-14-6-3-5-13-4-1-2-7-15(13)14/h1-10,32H,11H2/b31-10+ |
| InChIKey | PANABBRMYLRYGQ-VNTWQREPSA-N |
| XLogP | 7.50 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|