C17H11F8IN2O — CID 126048512
1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]propan-1-amine (PubChem CID 126048512) has the molecular formula C17H11F8IN2O and a molecular weight of 538.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126048512 |
| Molecular Formula | C17H11F8IN2O |
| Molecular Weight | 538.18 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[(2-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]propan-1-amine |
| SMILES | Fc1ccccc1COc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1I |
| InChI | InChI=1S/C17H11F8IN2O/c18-12-4-2-1-3-11(12)9-29-14-6-5-10(7-13(14)26)8-27-28-17(24,25)15(19,20)16(21,22)23/h1-8,28H,9H2/b27-8+ |
| InChIKey | BHSCTVCEXNUUHM-FLUNURKVSA-N |
| XLogP | 5.72 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.18 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|