C17H13F7N2O — CID 126048176
1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]propan-1-amine (PubChem CID 126048176) has the molecular formula C17H13F7N2O and a molecular weight of 394.29 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126048176 |
| Molecular Formula | C17H13F7N2O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]propan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H13F7N2O/c18-15(19,16(20,21)22)17(23,24)26-25-10-12-6-8-14(9-7-12)27-11-13-4-2-1-3-5-13/h1-10,26H,11H2/b25-10+ |
| InChIKey | JMSHZQJTJLKDFQ-KIBLKLHPSA-N |
| XLogP | 4.98 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|