C21H13F7N2O — CID 5004757
2,3,5,6-tetrafluoro-N-[(4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 5004757) has the molecular formula C21H13F7N2O and a molecular weight of 442.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 5004757 |
| Molecular Formula | C21H13F7N2O |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NN=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H13F7N2O/c22-16-15(21(26,27)28)17(23)19(25)20(18(16)24)30-29-10-12-6-8-14(9-7-12)31-11-13-4-2-1-3-5-13/h1-10,30H,11H2 |
| InChIKey | GOQDZYWEGURWJT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|