C15H9F5N2O3 — CID 9466391
2-[4-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 9466391) has the molecular formula C15H9F5N2O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is 2-[4-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9466391 |
| Molecular Formula | C15H9F5N2O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[4-[(Z)-[(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N\Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H9F5N2O3/c16-10-11(17)13(19)15(14(20)12(10)18)22-21-5-7-1-3-8(4-2-7)25-6-9(23)24/h1-5,22H,6H2,(H,23,24)/b21-5- |
| InChIKey | ZYYJFXNRSINIPK-SQFVCTCFSA-N |
| XLogP | 3.29 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|