C14H11BrN2O5 — CID 6261259
2-[4-[(Z)-[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6261259) has the molecular formula C14H11BrN2O5 and a molecular weight of 367.16 g/mol. Its IUPAC name is 2-[4-[(Z)-[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6261259 |
| Molecular Formula | C14H11BrN2O5 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-[4-[(Z)-[(5-bromofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N\NC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C14H11BrN2O5/c15-12-6-5-11(22-12)14(20)17-16-7-9-1-3-10(4-2-9)21-8-13(18)19/h1-7H,8H2,(H,17,20)(H,18,19)/b16-7- |
| InChIKey | LAAJZFIZAUAHNC-APSNUPSMSA-N |
| XLogP | 2.27 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|