C16H13BrN2O5 — CID 21370779
2-[4-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 21370779) has the molecular formula C16H13BrN2O5 and a molecular weight of 393.19 g/mol. Its IUPAC name is 2-[4-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21370779 |
| Molecular Formula | C16H13BrN2O5 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-[4-[(E)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N/NC(=O)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C16H13BrN2O5/c17-11-3-6-14(20)13(7-11)16(23)19-18-8-10-1-4-12(5-2-10)24-9-15(21)22/h1-8,20H,9H2,(H,19,23)(H,21,22)/b18-8+ |
| InChIKey | BACBEBDORZZJJC-QGMBQPNBSA-N |
| XLogP | 2.38 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|