C19H21N3O3S — CID 9256110
2-[4-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 9256110) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9256110 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[4-[(Z)-[(4-propan-2-ylphenyl)carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CC(C)c1ccc(NC(=S)N/N=C\c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13(2)15-5-7-16(8-6-15)21-19(26)22-20-11-14-3-9-17(10-4-14)25-12-18(23)24/h3-11,13H,12H2,1-2H3,(H,23,24)(H2,21,22,26)/b20-11- |
| InChIKey | GDMLBEAPVLBNAY-JAIQZWGSSA-N |
| XLogP | 3.59 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|