C14H6ClF7N2 — CID 134123964
N-[(E)-(3-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 134123964) has the molecular formula C14H6ClF7N2 and a molecular weight of 370.66 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134123964 |
| Molecular Formula | C14H6ClF7N2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1N/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H6ClF7N2/c15-7-3-1-2-6(4-7)5-23-24-13-11(18)9(16)8(14(20,21)22)10(17)12(13)19/h1-5,24H/b23-5+ |
| InChIKey | IDFKSJAKRZOLAV-MUDSWDHVSA-N |
| XLogP | 5.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|