C16H10ClF7N2O2 — CID 135716080
2-chloro-6-ethoxy-4-[(E)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol (PubChem CID 135716080) has the molecular formula C16H10ClF7N2O2 and a molecular weight of 430.71 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-4-[(E)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-chloro-6-ethoxy-4-[(E)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135716080 |
| Molecular Formula | C16H10ClF7N2O2 |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2-chloro-6-ethoxy-4-[(E)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N/Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc(Cl)c1O |
| InChI | InChI=1S/C16H10ClF7N2O2/c1-2-28-8-4-6(3-7(17)15(8)27)5-25-26-14-12(20)10(18)9(16(22,23)24)11(19)13(14)21/h3-5,26-27H,2H2,1H3/b25-5+ |
| InChIKey | ZSUHLNNMMGSEKE-VVAXDPKNSA-N |
| XLogP | 5.47 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|