C14H19ClN2O4 — CID 136831624
tert-butyl N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]carbamate (PubChem CID 136831624) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is tert-butyl N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 136831624 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | tert-butyl N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]carbamate |
| SMILES | CCOc1cc(/C=N\NC(=O)OC(C)(C)C)cc(Cl)c1O |
| InChI | InChI=1S/C14H19ClN2O4/c1-5-20-11-7-9(6-10(15)12(11)18)8-16-17-13(19)21-14(2,3)4/h6-8,18H,5H2,1-4H3,(H,17,19)/b16-8- |
| InChIKey | BQDNDWFYFGHIMD-PXNMLYILSA-N |
| XLogP | 3.30 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|