C22H13F7N4O6 — CID 6245798
N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 6245798) has the molecular formula C22H13F7N4O6 and a molecular weight of 562.35 g/mol. Its IUPAC name is N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 6245798 |
| Molecular Formula | C22H13F7N4O6 |
| Molecular Weight | 562.35 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(/C=N\Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H13F7N4O6/c1-2-38-15-7-10(3-5-14(15)39-13-6-4-11(32(34)35)8-12(13)33(36)37)9-30-31-21-19(25)17(23)16(22(27,28)29)18(24)20(21)26/h3-9,31H,2H2,1H3/b30-9- |
| InChIKey | FTGSSACAJBHNDH-LZWSGYTISA-N |
| XLogP | 6.72 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.35 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|