C15H12F4N2O2 — CID 135613721
2-ethoxy-4-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135613721) has the molecular formula C15H12F4N2O2 and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-ethoxy-4-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-ethoxy-4-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135613721 |
| Molecular Formula | C15H12F4N2O2 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-ethoxy-4-[(E)-[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N/Nc2c(F)c(F)cc(F)c2F)ccc1O |
| InChI | InChI=1S/C15H12F4N2O2/c1-2-23-12-5-8(3-4-11(12)22)7-20-21-15-13(18)9(16)6-10(17)14(15)19/h3-7,21-22H,2H2,1H3/b20-7+ |
| InChIKey | BLJHCYRKGWGNHC-IFRROFPPSA-N |
| XLogP | 3.79 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|