C17H9F7N4 — CID 2859728
2,3,5,6-tetrafluoro-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 2859728) has the molecular formula C17H9F7N4 and a molecular weight of 402.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2859728 |
| Molecular Formula | C17H9F7N4 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NN=Cc1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C17H9F7N4/c18-11-10(17(22,23)24)12(19)14(21)16(13(11)20)28-26-7-9-6-25-27-15(9)8-4-2-1-3-5-8/h1-7,28H,(H,25,27) |
| InChIKey | XLYLMGAARSSWEV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|