C14H5F7N4O4 — CID 134108768
N-[(E)-(2,6-dinitrophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 134108768) has the molecular formula C14H5F7N4O4 and a molecular weight of 426.20 g/mol. Its IUPAC name is N-[(E)-(2,6-dinitrophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-(2,6-dinitrophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134108768 |
| Molecular Formula | C14H5F7N4O4 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | N-[(E)-(2,6-dinitrophenyl)methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1/C=N/Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H5F7N4O4/c15-9-8(14(19,20)21)10(16)12(18)13(11(9)17)23-22-4-5-6(24(26)27)2-1-3-7(5)25(28)29/h1-4,23H/b22-4+ |
| InChIKey | CUMYSMKVEZENOX-LKNXVUQUSA-N |
| XLogP | 4.52 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|