C14H16F3N4O2+ — CID 135850472
N-[(E)-[2-nitro-6-(trifluoromethyl)phenyl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine (PubChem CID 135850472) has the molecular formula C14H16F3N4O2+ and a molecular weight of 329.30 g/mol. Its IUPAC name is N-[(E)-[2-nitro-6-(trifluoromethyl)phenyl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine.
| Compound Name | N-[(E)-[2-nitro-6-(trifluoromethyl)phenyl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
|---|---|
| PubChem CID | 135850472 |
| Molecular Formula | C14H16F3N4O2+ |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[(E)-[2-nitro-6-(trifluoromethyl)phenyl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
| SMILES | O=[N+]([O-])c1cccc(C(F)(F)F)c1/C=N/NC1=[NH+]CCCCC1 |
| InChI | InChI=1S/C14H15F3N4O2/c15-14(16,17)11-5-4-6-12(21(22)23)10(11)9-19-20-13-7-2-1-3-8-18-13/h4-6,9H,1-3,7-8H2,(H,18,20)/p+1/b19-9+ |
| InChIKey | TUDVATVQUXCNPO-DJKKODMXSA-O |
| XLogP | 1.59 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|