C14H20N3O+ — CID 135796941
N-[(E)-(2-methoxyphenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine (PubChem CID 135796941) has the molecular formula C14H20N3O+ and a molecular weight of 246.33 g/mol. Its IUPAC name is N-[(E)-(2-methoxyphenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine.
| Compound Name | N-[(E)-(2-methoxyphenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
|---|---|
| PubChem CID | 135796941 |
| Molecular Formula | C14H20N3O+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-[(E)-(2-methoxyphenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-1-ium-7-amine |
| SMILES | COc1ccccc1/C=N/NC1=[NH+]CCCCC1 |
| InChI | InChI=1S/C14H19N3O/c1-18-13-8-5-4-7-12(13)11-16-17-14-9-3-2-6-10-15-14/h4-5,7-8,11H,2-3,6,9-10H2,1H3,(H,15,17)/p+1/b16-11+ |
| InChIKey | CDYUBGFAYXLJDK-LFIBNONCSA-O |
| XLogP | 0.67 |
| TPSA | 47.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|