C13H6F5N3O2 — CID 3634542
3-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]aniline (PubChem CID 3634542) has the molecular formula C13H6F5N3O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 3-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]aniline.
| Compound Name | 3-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3634542 |
| Molecular Formula | C13H6F5N3O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1cccc(NN=Cc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H6F5N3O2/c14-9-8(10(15)12(17)13(18)11(9)16)5-19-20-6-2-1-3-7(4-6)21(22)23/h1-5,20H |
| InChIKey | XLOKTNNSKKEIKK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|