C13H9F2N3O2 — CID 9077545
N-[(Z)-(3,4-difluorophenyl)methylideneamino]-3-nitroaniline (PubChem CID 9077545) has the molecular formula C13H9F2N3O2 and a molecular weight of 277.23 g/mol. Its IUPAC name is N-[(Z)-(3,4-difluorophenyl)methylideneamino]-3-nitroaniline.
| Compound Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-3-nitroaniline |
|---|---|
| PubChem CID | 9077545 |
| Molecular Formula | C13H9F2N3O2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]-3-nitroaniline |
| SMILES | O=[N+]([O-])c1cccc(N/N=C\c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H9F2N3O2/c14-12-5-4-9(6-13(12)15)8-16-17-10-2-1-3-11(7-10)18(19)20/h1-8,17H/b16-8- |
| InChIKey | PWDSSOSNXULUPT-PXNMLYILSA-N |
| XLogP | 3.32 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|