C13H10F2N2 — CID 6107807
N-[(Z)-(3,4-difluorophenyl)methylideneamino]aniline (PubChem CID 6107807) has the molecular formula C13H10F2N2 and a molecular weight of 232.23 g/mol. Its IUPAC name is N-[(Z)-(3,4-difluorophenyl)methylideneamino]aniline.
| Compound Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6107807 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-[(Z)-(3,4-difluorophenyl)methylideneamino]aniline |
| SMILES | Fc1ccc(/C=N\Nc2ccccc2)cc1F |
| InChI | InChI=1S/C13H10F2N2/c14-12-7-6-10(8-13(12)15)9-16-17-11-4-2-1-3-5-11/h1-9,17H/b16-9- |
| InChIKey | KNPIOSWPEQOXAE-SXGWCWSVSA-N |
| XLogP | 3.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|