C15H11F3N4O5 — CID 8002574
N-[(Z)-(3-methoxyphenyl)methylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 8002574) has the molecular formula C15H11F3N4O5 and a molecular weight of 384.27 g/mol. Its IUPAC name is N-[(Z)-(3-methoxyphenyl)methylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-(3-methoxyphenyl)methylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 8002574 |
| Molecular Formula | C15H11F3N4O5 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[(Z)-(3-methoxyphenyl)methylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cccc(/C=N\Nc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11F3N4O5/c1-27-11-4-2-3-9(5-11)8-19-20-14-12(21(23)24)6-10(15(16,17)18)7-13(14)22(25)26/h2-8,20H,1H3/b19-8- |
| InChIKey | WWYBQZLNTKVSOA-UWVJOHFNSA-N |
| XLogP | 3.98 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|