C15H8F5N3O2 — CID 9466475
2,3,4,5,6-pentafluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline (PubChem CID 9466475) has the molecular formula C15H8F5N3O2 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline |
|---|---|
| PubChem CID | 9466475 |
| Molecular Formula | C15H8F5N3O2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline |
| SMILES | O=[N+]([O-])c1ccccc1/C=C/C=N\Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F5N3O2/c16-10-11(17)13(19)15(14(20)12(10)18)22-21-7-3-5-8-4-1-2-6-9(8)23(24)25/h1-7,22H/b5-3+,21-7- |
| InChIKey | NXXQRKSNUAAWOA-YTQDUARFSA-N |
| XLogP | 4.40 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|