C15H10ClF3N4O2 — CID 6902838
3-chloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 6902838) has the molecular formula C15H10ClF3N4O2 and a molecular weight of 370.72 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 6902838 |
| Molecular Formula | C15H10ClF3N4O2 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-chloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccccc1/C=C/C=N/Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H10ClF3N4O2/c16-12-8-11(15(17,18)19)9-20-14(12)22-21-7-3-5-10-4-1-2-6-13(10)23(24)25/h1-9H,(H,20,22)/b5-3+,21-7+ |
| InChIKey | PTJBMTXSCNGMKM-JAZWXOFISA-N |
| XLogP | 4.77 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|