C14H10Cl2N4O2 — CID 6892976
3,5-dichloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyridin-2-amine (PubChem CID 6892976) has the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 3,5-dichloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyridin-2-amine |
|---|---|
| PubChem CID | 6892976 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 3,5-dichloro-N-[(E)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccccc1/C=C/C=N/Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N4O2/c15-11-8-12(16)14(17-9-11)19-18-7-3-5-10-4-1-2-6-13(10)20(21)22/h1-9H,(H,17,19)/b5-3+,18-7+ |
| InChIKey | GSGAEHQEJCDXGR-KDOXUUJXSA-N |
| XLogP | 4.41 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|