C14H11Cl2N3O2 — CID 8980058
methyl 2-[(Z)-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate (PubChem CID 8980058) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is methyl 2-[(Z)-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 2-[(Z)-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8980058 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | methyl 2-[(Z)-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=N\Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O2/c1-21-14(20)11-5-3-2-4-9(11)7-18-19-13-12(16)6-10(15)8-17-13/h2-8H,1H3,(H,17,19)/b18-7- |
| InChIKey | FZAFXNPWUAEPHH-WSVATBPTSA-N |
| XLogP | 3.62 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|